C29H40N2O3S — CID 10006046
N-butyl-N-[3-[4-(2-propan-2-ylquinolin-3-yl)sulfonylphenoxy]propyl]butan-1-amine (PubChem CID 10006046) has the molecular formula C29H40N2O3S and a molecular weight of 496.72 g/mol. Its IUPAC name is N-butyl-N-[3-[4-(2-propan-2-ylquinolin-3-yl)sulfonylphenoxy]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[3-[4-(2-propan-2-ylquinolin-3-yl)sulfonylphenoxy]propyl]butan-1-amine |
|---|---|
| PubChem CID | 10006046 |
| Molecular Formula | C29H40N2O3S |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-butyl-N-[3-[4-(2-propan-2-ylquinolin-3-yl)sulfonylphenoxy]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCOc1ccc(S(=O)(=O)c2cc3ccccc3nc2C(C)C)cc1 |
| InChI | InChI=1S/C29H40N2O3S/c1-5-7-18-31(19-8-6-2)20-11-21-34-25-14-16-26(17-15-25)35(32,33)28-22-24-12-9-10-13-27(24)30-29(28)23(3)4/h9-10,12-17,22-23H,5-8,11,18-21H2,1-4H3 |
| InChIKey | WKNRGRCXVFHZJR-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|