C26H37NO7S — CID 14751828
N-butyl-N-[3-[4-(4-methylphenyl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid (PubChem CID 14751828) has the molecular formula C26H37NO7S and a molecular weight of 507.65 g/mol. Its IUPAC name is N-butyl-N-[3-[4-(4-methylphenyl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid.
| Compound Name | N-butyl-N-[3-[4-(4-methylphenyl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 14751828 |
| Molecular Formula | C26H37NO7S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-butyl-N-[3-[4-(4-methylphenyl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid |
| SMILES | CCCCN(CCCC)CCCOc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H35NO3S.C2H2O4/c1-4-6-17-25(18-7-5-2)19-8-20-28-22-11-15-24(16-12-22)29(26,27)23-13-9-21(3)10-14-23;3-1(4)2(5)6/h9-16H,4-8,17-20H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | MLJXFMKTWTYNJH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|