C27H39ClN2O3S — CID 19800255
N-butyl-N-[3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propyl]butan-1-amine;hydrochloride (PubChem CID 19800255) has the molecular formula C27H39ClN2O3S and a molecular weight of 507.14 g/mol. Its IUPAC name is N-butyl-N-[3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propyl]butan-1-amine;hydrochloride.
| Compound Name | N-butyl-N-[3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 19800255 |
| Molecular Formula | C27H39ClN2O3S |
| Molecular Weight | 507.14 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-butyl-N-[3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propyl]butan-1-amine;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOc1ccc(S(=O)(=O)c2c(CC)cn3ccccc23)cc1.Cl |
| InChI | InChI=1S/C27H38N2O3S.ClH/c1-4-7-17-28(18-8-5-2)19-11-21-32-24-13-15-25(16-14-24)33(30,31)27-23(6-3)22-29-20-10-9-12-26(27)29;/h9-10,12-16,20,22H,4-8,11,17-19,21H2,1-3H3;1H |
| InChIKey | GOJLFELDGDGKFH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.14 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|