C31H36N2O9S — CID 19800280
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propan-1-amine;oxalic acid (PubChem CID 19800280) has the molecular formula C31H36N2O9S and a molecular weight of 612.70 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propan-1-amine;oxalic acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 19800280 |
| Molecular Formula | C31H36N2O9S |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(2-ethylindolizin-1-yl)sulfonylphenoxy]propan-1-amine;oxalic acid |
| SMILES | CCc1cn2ccccc2c1S(=O)(=O)c1ccc(OCCCNCCc2ccc(OC)c(OC)c2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H34N2O5S.C2H2O4/c1-4-23-21-31-18-6-5-8-26(31)29(23)37(32,33)25-12-10-24(11-13-25)36-19-7-16-30-17-15-22-9-14-27(34-2)28(20-22)35-3;3-1(4)2(5)6/h5-6,8-14,18,20-21,30H,4,7,15-17,19H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | PUHYAXFGUGZEDL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|