C27H32N2O9S — CID 19759124
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(4-pyridin-2-ylsulfonylphenoxy)propan-1-amine;oxalic acid (PubChem CID 19759124) has the molecular formula C27H32N2O9S and a molecular weight of 560.63 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(4-pyridin-2-ylsulfonylphenoxy)propan-1-amine;oxalic acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(4-pyridin-2-ylsulfonylphenoxy)propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 19759124 |
| Molecular Formula | C27H32N2O9S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-(4-pyridin-2-ylsulfonylphenoxy)propan-1-amine;oxalic acid |
| SMILES | COc1ccc(CCN(C)CCCOc2ccc(S(=O)(=O)c3ccccn3)cc2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H30N2O5S.C2H2O4/c1-27(17-14-20-8-13-23(30-2)24(19-20)31-3)16-6-18-32-21-9-11-22(12-10-21)33(28,29)25-7-4-5-15-26-25;3-1(4)2(5)6/h4-5,7-13,15,19H,6,14,16-18H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SVGDIUAYWFXXAS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|