C29H39NO10S — CID 19759102
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(5-propan-2-yl-2,3-dihydrofuran-4-yl)sulfonyl]phenoxy]propan-1-amine;oxalic acid (PubChem CID 19759102) has the molecular formula C29H39NO10S and a molecular weight of 593.70 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(5-propan-2-yl-2,3-dihydrofuran-4-yl)sulfonyl]phenoxy]propan-1-amine;oxalic acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(5-propan-2-yl-2,3-dihydrofuran-4-yl)sulfonyl]phenoxy]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 19759102 |
| Molecular Formula | C29H39NO10S |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(5-propan-2-yl-2,3-dihydrofuran-4-yl)sulfonyl]phenoxy]propan-1-amine;oxalic acid |
| SMILES | COc1ccc(CCN(C)CCCOc2ccc(S(=O)(=O)C3=C(C(C)C)OCC3)cc2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H37NO6S.C2H2O4/c1-20(2)27-26(14-18-34-27)35(29,30)23-10-8-22(9-11-23)33-17-6-15-28(3)16-13-21-7-12-24(31-4)25(19-21)32-5;3-1(4)2(5)6/h7-12,19-20H,6,13-18H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | TVVFLLXXYKPBPU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|