C16H22ClNO6 — CID 67770027
2-[1-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-2-oxoacetic acid (PubChem CID 67770027) has the molecular formula C16H22ClNO6 and a molecular weight of 359.81 g/mol. Its IUPAC name is 2-[1-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-2-oxoacetic acid.
| Compound Name | 2-[1-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67770027 |
| Molecular Formula | C16H22ClNO6 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[1-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-2-oxoacetic acid |
| SMILES | COc1ccc(CCN(C)CCC(Cl)OC(=O)C(=O)O)cc1OC |
| InChI | InChI=1S/C16H22ClNO6/c1-18(9-7-14(17)24-16(21)15(19)20)8-6-11-4-5-12(22-2)13(10-11)23-3/h4-5,10,14H,6-9H2,1-3H3,(H,19,20) |
| InChIKey | HLCWHPIASSOMAU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|