C31H45NO6 — CID 67936209
5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-[(1R,2R)-6,7-dimethoxy-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]pentanoic acid (PubChem CID 67936209) has the molecular formula C31H45NO6 and a molecular weight of 527.70 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-[(1R,2R)-6,7-dimethoxy-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]pentanoic acid.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-[(1R,2R)-6,7-dimethoxy-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 67936209 |
| Molecular Formula | C31H45NO6 |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-[(1R,2R)-6,7-dimethoxy-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]pentanoic acid |
| SMILES | COc1ccc(CCN(C)CCCC(C(=O)O)[C@@H]2CCc3cc(OC)c(OC)cc3[C@@H]2C(C)C)cc1OC |
| InChI | InChI=1S/C31H45NO6/c1-20(2)30-23(12-11-22-18-28(37-6)29(38-7)19-25(22)30)24(31(33)34)9-8-15-32(3)16-14-21-10-13-26(35-4)27(17-21)36-5/h10,13,17-20,23-24,30H,8-9,11-12,14-16H2,1-7H3,(H,33,34)/t23-,24?,30+/m0/s1 |
| InChIKey | XJCCOIGBGPJUGX-LSMKNSMVSA-N |
| XLogP | 5.68 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |