C30H42FNO6 — CID 67936984
[4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-methoxybutyl] [(1S,2R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl] carbonate (PubChem CID 67936984) has the molecular formula C30H42FNO6 and a molecular weight of 531.67 g/mol. Its IUPAC name is [4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-methoxybutyl] [(1S,2R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl] carbonate.
| Compound Name | [4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-methoxybutyl] [(1S,2R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl] carbonate |
|---|---|
| PubChem CID | 67936984 |
| Molecular Formula | C30H42FNO6 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | [4-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-methoxybutyl] [(1S,2R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl] carbonate |
| SMILES | COc1ccc(CCN(C)CCC(COC(=O)O[C@@H]2CCc3cc(F)ccc3[C@@H]2C(C)C)OC)cc1OC |
| InChI | InChI=1S/C30H42FNO6/c1-20(2)29-25-10-9-23(31)18-22(25)8-12-27(29)38-30(33)37-19-24(34-4)14-16-32(3)15-13-21-7-11-26(35-5)28(17-21)36-6/h7,9-11,17-18,20,24,27,29H,8,12-16,19H2,1-6H3/t24?,27-,29+/m1/s1 |
| InChIKey | UGRCKCAGSSORBQ-NSYPLHIYSA-N |
| XLogP | 5.63 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |