C30H42FNO5 — CID 70370599
(2R)-4-[3-(3,4-dimethoxyphenyl)propyl-methylamino]-2-[[(1R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid (PubChem CID 70370599) has the molecular formula C30H42FNO5 and a molecular weight of 515.67 g/mol. Its IUPAC name is (2R)-4-[3-(3,4-dimethoxyphenyl)propyl-methylamino]-2-[[(1R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid.
| Compound Name | (2R)-4-[3-(3,4-dimethoxyphenyl)propyl-methylamino]-2-[[(1R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid |
|---|---|
| PubChem CID | 70370599 |
| Molecular Formula | C30H42FNO5 |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | (2R)-4-[3-(3,4-dimethoxyphenyl)propyl-methylamino]-2-[[(1R)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid |
| SMILES | COc1ccc(CCCN(C)CC[C@@H](OCC2CCc3cc(F)ccc3[C@@H]2C(C)C)C(=O)O)cc1OC |
| InChI | InChI=1S/C30H42FNO5/c1-20(2)29-23(10-9-22-18-24(31)11-12-25(22)29)19-37-27(30(33)34)14-16-32(3)15-6-7-21-8-13-26(35-4)28(17-21)36-5/h8,11-13,17-18,20,23,27,29H,6-7,9-10,14-16,19H2,1-5H3,(H,33,34)/t23?,27-,29-/m1/s1 |
| InChIKey | RNIZPAKCCPBSDY-AVDMRMMTSA-N |
| XLogP | 5.57 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |