C33H46ClFN2O3S — CID 70042468
(2S)-4-[7-(1,3-benzothiazol-2-yl)heptyl-methylamino]-2-[[(1S)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid;hydrochloride (PubChem CID 70042468) has the molecular formula C33H46ClFN2O3S and a molecular weight of 605.26 g/mol. Its IUPAC name is (2S)-4-[7-(1,3-benzothiazol-2-yl)heptyl-methylamino]-2-[[(1S)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid;hydrochloride.
| Compound Name | (2S)-4-[7-(1,3-benzothiazol-2-yl)heptyl-methylamino]-2-[[(1S)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70042468 |
| Molecular Formula | C33H46ClFN2O3S |
| Molecular Weight | 605.26 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | (2S)-4-[7-(1,3-benzothiazol-2-yl)heptyl-methylamino]-2-[[(1S)-6-fluoro-1-propan-2-yl-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]butanoic acid;hydrochloride |
| SMILES | CC(C)[C@@H]1c2ccc(F)cc2CCC1CO[C@@H](CCN(C)CCCCCCCc1nc2ccccc2s1)C(=O)O.Cl |
| InChI | InChI=1S/C33H45FN2O3S.ClH/c1-23(2)32-25(15-14-24-21-26(34)16-17-27(24)32)22-39-29(33(37)38)18-20-36(3)19-10-6-4-5-7-13-31-35-28-11-8-9-12-30(28)40-31;/h8-9,11-12,16-17,21,23,25,29,32H,4-7,10,13-15,18-20,22H2,1-3H3,(H,37,38);1H/t25?,29-,32-;/m0./s1 |
| InChIKey | MNZGQCAIZDFXOT-DIRNYADHSA-N |
| XLogP | 8.14 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.26 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|