3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid

C16H12FNO2S — CID 104631531

IUPAC3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid
SMILESO=C(O)C(Cc1nc2ccccc2s1)c1cccc(F)c1
InChIInChI=1S/C16H12FNO2S/c17-11-5-3-4-10(8-11)12(16(19)20)9-15-18-13-6-1-2-7-14(13)21-15/h1-8,12H,9H2,(H,19,20)
InChIKeyMHBIDBNLMITAJV-UHFFFAOYSA-N
MW301.34 g/mol
LogP3.85
Rot. Bonds4

About 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid

3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid (PubChem CID 104631531) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid.

Molecular Properties

Compound Name3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid
PubChem CID104631531
Molecular FormulaC16H12FNO2S
Molecular Weight301.34 g/mol
Exact Mass301.06
IUPAC Name3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid
SMILESO=C(O)C(Cc1nc2ccccc2s1)c1cccc(F)c1
InChIInChI=1S/C16H12FNO2S/c17-11-5-3-4-10(8-11)12(16(19)20)9-15-18-13-6-1-2-7-14(13)21-15/h1-8,12H,9H2,(H,19,20)
InChIKeyMHBIDBNLMITAJV-UHFFFAOYSA-N
XLogP3.85
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.34
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid (CID 104631531) is 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid is O=C(O)C(Cc1nc2ccccc2s1)c1cccc(F)c1.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid?
The InChIKey is MHBIDBNLMITAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO2S/c17-11-5-3-4-10(8-11)12(16(19)20)9-15-18-13-6-1-2-7-14(13)21-15/h1-8,12H,9H2,(H,19,20).
What are the key properties of 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid?
3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid has a molecular weight of 301.34 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid is sourced from PubChem (CID 104631531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).