C16H12FNO2S — CID 104631531
3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid (PubChem CID 104631531) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 104631531 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-(3-fluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1nc2ccccc2s1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12FNO2S/c17-11-5-3-4-10(8-11)12(16(19)20)9-15-18-13-6-1-2-7-14(13)21-15/h1-8,12H,9H2,(H,19,20) |
| InChIKey | MHBIDBNLMITAJV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |