C32H39NO6S — CID 152759009
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-[(2-propan-2-yl-1-benzofuran-3-yl)sulfonyl]phenoxy]butan-1-amine (PubChem CID 152759009) has the molecular formula C32H39NO6S and a molecular weight of 565.73 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-[(2-propan-2-yl-1-benzofuran-3-yl)sulfonyl]phenoxy]butan-1-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-[(2-propan-2-yl-1-benzofuran-3-yl)sulfonyl]phenoxy]butan-1-amine |
|---|---|
| PubChem CID | 152759009 |
| Molecular Formula | C32H39NO6S |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-[(2-propan-2-yl-1-benzofuran-3-yl)sulfonyl]phenoxy]butan-1-amine |
| SMILES | COc1ccc(CCN(C)CCCCOc2ccc(S(=O)(=O)c3c(C(C)C)oc4ccccc34)cc2)cc1OC |
| InChI | InChI=1S/C32H39NO6S/c1-23(2)31-32(27-10-6-7-11-28(27)39-31)40(34,35)26-15-13-25(14-16-26)38-21-9-8-19-33(3)20-18-24-12-17-29(36-4)30(22-24)37-5/h6-7,10-17,22-23H,8-9,18-21H2,1-5H3 |
| InChIKey | DUMKPVIBYWZPCM-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|