C28H31N3O3S — CID 19759177
3-(4-cinnolin-3-ylsulfanylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine (PubChem CID 19759177) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is 3-(4-cinnolin-3-ylsulfanylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine.
| Compound Name | 3-(4-cinnolin-3-ylsulfanylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 19759177 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 3-(4-cinnolin-3-ylsulfanylphenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine |
| SMILES | COc1ccc(CCN(C)CCCOc2ccc(Sc3cc4ccccc4nn3)cc2)cc1OC |
| InChI | InChI=1S/C28H31N3O3S/c1-31(17-15-21-9-14-26(32-2)27(19-21)33-3)16-6-18-34-23-10-12-24(13-11-23)35-28-20-22-7-4-5-8-25(22)29-30-28/h4-5,7-14,19-20H,6,15-18H2,1-3H3 |
| InChIKey | ILODMFRNUAVTGQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|