C24H31N3O5 — CID 135554910
4-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-1H-pyrazol-5-yl]-2-methoxyphenol (PubChem CID 135554910) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-1H-pyrazol-5-yl]-2-methoxyphenol.
| Compound Name | 4-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-1H-pyrazol-5-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135554910 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propoxy]-1H-pyrazol-5-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2cc(OCCCN(C)CCc3ccc(OC)c(OC)c3)n[nH]2)ccc1O |
| InChI | InChI=1S/C24H31N3O5/c1-27(12-10-17-6-9-21(29-2)23(14-17)31-4)11-5-13-32-24-16-19(25-26-24)18-7-8-20(28)22(15-18)30-3/h6-9,14-16,28H,5,10-13H2,1-4H3,(H,25,26) |
| InChIKey | USPNXSXGXHKPCZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|