C21H24N2O4 — CID 14578497
4-[2-[3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-1H-pyrazol-5-yl]ethyl]-2-methoxyphenol (PubChem CID 14578497) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-1H-pyrazol-5-yl]ethyl]-2-methoxyphenol.
| Compound Name | 4-[2-[3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-1H-pyrazol-5-yl]ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 14578497 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-[2-[3-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-1H-pyrazol-5-yl]ethyl]-2-methoxyphenol |
| SMILES | COc1cc(CCc2cc(CCc3ccc(O)c(OC)c3)[nH]n2)ccc1O |
| InChI | InChI=1S/C21H24N2O4/c1-26-20-11-14(5-9-18(20)24)3-7-16-13-17(23-22-16)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-13,24-25H,3-4,7-8H2,1-2H3,(H,22,23) |
| InChIKey | VOARGTPHOPZXSJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |