C33H42N2O4S — CID 58693482
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenyl]butan-1-amine (PubChem CID 58693482) has the molecular formula C33H42N2O4S and a molecular weight of 562.78 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenyl]butan-1-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenyl]butan-1-amine |
|---|---|
| PubChem CID | 58693482 |
| Molecular Formula | C33H42N2O4S |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[4-(1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenyl]butan-1-amine |
| SMILES | COc1ccc(CCN(C)CCCCc2ccc(S(=O)(=O)c3c(C(C)C)c4ccccc4n3C)cc2)cc1OC |
| InChI | InChI=1S/C33H42N2O4S/c1-24(2)32-28-12-7-8-13-29(28)35(4)33(32)40(36,37)27-17-14-25(15-18-27)11-9-10-21-34(3)22-20-26-16-19-30(38-5)31(23-26)39-6/h7-8,12-19,23-24H,9-11,20-22H2,1-6H3 |
| InChIKey | XKTKJSOQTPTZHX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|