C24H34ClN3O — CID 52947788
N-butyl-N-[3-(4-imidazo[1,2-a]pyridin-2-ylphenoxy)propyl]butan-1-amine;hydrochloride (PubChem CID 52947788) has the molecular formula C24H34ClN3O and a molecular weight of 416.01 g/mol. Its IUPAC name is N-butyl-N-[3-(4-imidazo[1,2-a]pyridin-2-ylphenoxy)propyl]butan-1-amine;hydrochloride.
| Compound Name | N-butyl-N-[3-(4-imidazo[1,2-a]pyridin-2-ylphenoxy)propyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 52947788 |
| Molecular Formula | C24H34ClN3O |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | N-butyl-N-[3-(4-imidazo[1,2-a]pyridin-2-ylphenoxy)propyl]butan-1-amine;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOc1ccc(-c2cn3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C24H33N3O.ClH/c1-3-5-15-26(16-6-4-2)17-9-19-28-22-13-11-21(12-14-22)23-20-27-18-8-7-10-24(27)25-23;/h7-8,10-14,18,20H,3-6,9,15-17,19H2,1-2H3;1H |
| InChIKey | AHMJGSZZZMMMDP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|