C18H27N3O — CID 142805755
3-[4-(1,2-dimethylimidazol-4-yl)phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 142805755) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-[4-(1,2-dimethylimidazol-4-yl)phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-(1,2-dimethylimidazol-4-yl)phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 142805755 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 3-[4-(1,2-dimethylimidazol-4-yl)phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(-c2cn(C)c(C)n2)cc1 |
| InChI | InChI=1S/C18H27N3O/c1-5-21(6-2)12-7-13-22-17-10-8-16(9-11-17)18-14-20(4)15(3)19-18/h8-11,14H,5-7,12-13H2,1-4H3 |
| InChIKey | BPPKTWXONADENN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|