C21H26N2OS — CID 135215156
2-(4-butoxyphenyl)-6-butylsulfanylimidazo[1,2-a]pyridine (PubChem CID 135215156) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-6-butylsulfanylimidazo[1,2-a]pyridine.
| Compound Name | 2-(4-butoxyphenyl)-6-butylsulfanylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 135215156 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-(4-butoxyphenyl)-6-butylsulfanylimidazo[1,2-a]pyridine |
| SMILES | CCCCOc1ccc(-c2cn3cc(SCCCC)ccc3n2)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-3-5-13-24-18-9-7-17(8-10-18)20-16-23-15-19(25-14-6-4-2)11-12-21(23)22-20/h7-12,15-16H,3-6,13-14H2,1-2H3 |
| InChIKey | ALQHBHKGAOVCEV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|