C18H19FN2O3 — CID 68587943
2-[4-(3-fluoropropoxy)phenyl]-6-(methoxymethoxy)imidazo[1,2-a]pyridine (PubChem CID 68587943) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[4-(3-fluoropropoxy)phenyl]-6-(methoxymethoxy)imidazo[1,2-a]pyridine.
| Compound Name | 2-[4-(3-fluoropropoxy)phenyl]-6-(methoxymethoxy)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 68587943 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[4-(3-fluoropropoxy)phenyl]-6-(methoxymethoxy)imidazo[1,2-a]pyridine |
| SMILES | COCOc1ccc2nc(-c3ccc(OCCCF)cc3)cn2c1 |
| InChI | InChI=1S/C18H19FN2O3/c1-22-13-24-16-7-8-18-20-17(12-21(18)11-16)14-3-5-15(6-4-14)23-10-2-9-19/h3-8,11-12H,2,9-10,13H2,1H3 |
| InChIKey | WLTTXGWAYISAOJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|