C15H16N2OS — CID 19224481
6-(4-butoxyphenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 19224481) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 6-(4-butoxyphenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(4-butoxyphenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 19224481 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 6-(4-butoxyphenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCOc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C15H16N2OS/c1-2-3-9-18-13-6-4-12(5-7-13)14-11-17-8-10-19-15(17)16-14/h4-8,10-11H,2-3,9H2,1H3 |
| InChIKey | GHRYSHDIVXRUKP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|