C11H7N5S — CID 150120131
6-(4-azidophenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 150120131) has the molecular formula C11H7N5S and a molecular weight of 241.28 g/mol. Its IUPAC name is 6-(4-azidophenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(4-azidophenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 150120131 |
| Molecular Formula | C11H7N5S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 6-(4-azidophenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | [N-]=[N+]=Nc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C11H7N5S/c12-15-14-9-3-1-8(2-4-9)10-7-16-5-6-17-11(16)13-10/h1-7H |
| InChIKey | DZBONAKYPSOUBT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|