C14H11N5S2 — CID 169363017
methyl N-cyano-N'-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)carbamimidothioate (PubChem CID 169363017) has the molecular formula C14H11N5S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is methyl N-cyano-N'-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169363017 |
| Molecular Formula | C14H11N5S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | methyl N-cyano-N'-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(-c2cn3ccsc3n2)cc1)NC#N |
| InChI | InChI=1S/C14H11N5S2/c1-20-13(16-9-15)17-11-4-2-10(3-5-11)12-8-19-6-7-21-14(19)18-12/h2-8H,1H3,(H,16,17) |
| InChIKey | SCBAVLOEQCZAOH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|