C21H16N4OS — CID 37039350
3-(4-cyanophenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)propanamide (PubChem CID 37039350) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)propanamide.
| Compound Name | 3-(4-cyanophenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)propanamide |
|---|---|
| PubChem CID | 37039350 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 3-(4-cyanophenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)propanamide |
| SMILES | N#Cc1ccc(CCC(=O)Nc2ccc(-c3cn4ccsc4n3)cc2)cc1 |
| InChI | InChI=1S/C21H16N4OS/c22-13-16-3-1-15(2-4-16)5-10-20(26)23-18-8-6-17(7-9-18)19-14-25-11-12-27-21(25)24-19/h1-4,6-9,11-12,14H,5,10H2,(H,23,26) |
| InChIKey | AWSSHBKPHDJDSZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |