C14H14N2OS — CID 115403295
6-[4-(2-methoxyethyl)phenyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 115403295) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 6-[4-(2-methoxyethyl)phenyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[4-(2-methoxyethyl)phenyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 115403295 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 6-[4-(2-methoxyethyl)phenyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | COCCc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C14H14N2OS/c1-17-8-6-11-2-4-12(5-3-11)13-10-16-7-9-18-14(16)15-13/h2-5,7,9-10H,6,8H2,1H3 |
| InChIKey | PYJBMNISPSBSQZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |