C9H6N2S2 — CID 10352957
6-thiophen-3-ylimidazo[2,1-b][1,3]thiazole (PubChem CID 10352957) has the molecular formula C9H6N2S2 and a molecular weight of 206.30 g/mol. Its IUPAC name is 6-thiophen-3-ylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-thiophen-3-ylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 10352957 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 6-thiophen-3-ylimidazo[2,1-b][1,3]thiazole |
| SMILES | c1cc(-c2cn3ccsc3n2)cs1 |
| InChI | InChI=1S/C9H6N2S2/c1-3-12-6-7(1)8-5-11-2-4-13-9(11)10-8/h1-6H |
| InChIKey | QNYBFCDYFVERKH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |