C12H10BrN3O2S2 — CID 83084144
1-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)methanesulfonamide (PubChem CID 83084144) has the molecular formula C12H10BrN3O2S2 and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 83084144 |
| Molecular Formula | C12H10BrN3O2S2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 1-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C12H10BrN3O2S2/c13-8-20(17,18)15-10-3-1-9(2-4-10)11-7-16-5-6-19-12(16)14-11/h1-7,15H,8H2 |
| InChIKey | ZSNHVDDKWCMMPU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|