C17H12BrN3O2S2 — CID 41427613
4-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide (PubChem CID 41427613) has the molecular formula C17H12BrN3O2S2 and a molecular weight of 434.34 g/mol. Its IUPAC name is 4-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 41427613 |
| Molecular Formula | C17H12BrN3O2S2 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 4-bromo-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2cn3ccsc3n2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrN3O2S2/c18-13-3-7-15(8-4-13)25(22,23)20-14-5-1-12(2-6-14)16-11-21-9-10-24-17(21)19-16/h1-11,20H |
| InChIKey | WRFSVUUQQPHCOK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |