C19H15N3O3S2 — CID 7151307
4-acetyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide (PubChem CID 7151307) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-acetyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7151307 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-acetyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2cccc(-c3cn4ccsc4n3)c2)cc1 |
| InChI | InChI=1S/C19H15N3O3S2/c1-13(23)14-5-7-17(8-6-14)27(24,25)21-16-4-2-3-15(11-16)18-12-22-9-10-26-19(22)20-18/h2-12,21H,1H3 |
| InChIKey | OWTMJHZOHPTMPR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |