C19H17N3O3S2 — CID 90518300
N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-phenoxyethanesulfonamide (PubChem CID 90518300) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-phenoxyethanesulfonamide.
| Compound Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-phenoxyethanesulfonamide |
|---|---|
| PubChem CID | 90518300 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-phenoxyethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccccc1)Nc1cccc(-c2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C19H17N3O3S2/c23-27(24,12-10-25-17-7-2-1-3-8-17)21-16-6-4-5-15(13-16)18-14-22-9-11-26-19(22)20-18/h1-9,11,13-14,21H,10,12H2 |
| InChIKey | JOPGCVIMTCJPOA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |