C13H14N4O2S2 — CID 7488202
6-[3-(dimethylsulfamoylamino)phenyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 7488202) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 6-[3-(dimethylsulfamoylamino)phenyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[3-(dimethylsulfamoylamino)phenyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 7488202 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 6-[3-(dimethylsulfamoylamino)phenyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | CN(C)S(=O)(=O)Nc1cccc(-c2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C13H14N4O2S2/c1-16(2)21(18,19)15-11-5-3-4-10(8-11)12-9-17-6-7-20-13(17)14-12/h3-9,15H,1-2H3 |
| InChIKey | IHMKQWCZYQYLDY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |