C22H21N3OS — CID 40506192
4-tert-butyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide (PubChem CID 40506192) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide.
| Compound Name | 4-tert-butyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
|---|---|
| PubChem CID | 40506192 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-tert-butyl-N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(-c3cn4ccsc4n3)c2)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-22(2,3)17-9-7-15(8-10-17)20(26)23-18-6-4-5-16(13-18)19-14-25-11-12-27-21(25)24-19/h4-14H,1-3H3,(H,23,26) |
| InChIKey | JEWHUHBWFYGCBW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |