C18H12IN3OS — CID 983313
N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-4-iodobenzamide (PubChem CID 983313) has the molecular formula C18H12IN3OS and a molecular weight of 445.29 g/mol. Its IUPAC name is N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-4-iodobenzamide.
| Compound Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 983313 |
| Molecular Formula | C18H12IN3OS |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-4-iodobenzamide |
| SMILES | O=C(Nc1cccc(-c2cn3ccsc3n2)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H12IN3OS/c19-14-6-4-12(5-7-14)17(23)20-15-3-1-2-13(10-15)16-11-22-8-9-24-18(22)21-16/h1-11H,(H,20,23) |
| InChIKey | DISSUDQTJRPIAB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|