C21H16N4OS — CID 45497443
N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-indol-1-ylacetamide (PubChem CID 45497443) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-indol-1-ylacetamide.
| Compound Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-indol-1-ylacetamide |
|---|---|
| PubChem CID | 45497443 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(3-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-2-indol-1-ylacetamide |
| SMILES | O=C(Cn1ccc2ccccc21)Nc1cccc(-c2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C21H16N4OS/c26-20(14-24-9-8-15-4-1-2-7-19(15)24)22-17-6-3-5-16(12-17)18-13-25-10-11-27-21(25)23-18/h1-13H,14H2,(H,22,26) |
| InChIKey | ZPFCOQYCERFYPP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |