C17H12N4O4S2 — CID 121028684
N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-nitrobenzenesulfonamide (PubChem CID 121028684) has the molecular formula C17H12N4O4S2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121028684 |
| Molecular Formula | C17H12N4O4S2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccc(-c3cn4ccsc4n3)cc2)c1 |
| InChI | InChI=1S/C17H12N4O4S2/c22-21(23)14-2-1-3-15(10-14)27(24,25)19-13-6-4-12(5-7-13)16-11-20-8-9-26-17(20)18-16/h1-11,19H |
| InChIKey | HAMDNASZZBJIDC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|