C14H14ClN3OS — CID 168639157
1-chloro-3-(4-imidazo[2,1-b][1,3]thiazol-6-ylanilino)propan-2-ol (PubChem CID 168639157) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 1-chloro-3-(4-imidazo[2,1-b][1,3]thiazol-6-ylanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(4-imidazo[2,1-b][1,3]thiazol-6-ylanilino)propan-2-ol |
|---|---|
| PubChem CID | 168639157 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-chloro-3-(4-imidazo[2,1-b][1,3]thiazol-6-ylanilino)propan-2-ol |
| SMILES | OC(CCl)CNc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C14H14ClN3OS/c15-7-12(19)8-16-11-3-1-10(2-4-11)13-9-18-5-6-20-14(18)17-13/h1-6,9,12,16,19H,7-8H2 |
| InChIKey | LWNDQGCEGIYYKH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|