C23H26N2OS — CID 19209873
2-(4-butoxyphenyl)-6-butylimidazo[2,1-b][1,3]benzothiazole (PubChem CID 19209873) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-6-butylimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(4-butoxyphenyl)-6-butylimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 19209873 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-(4-butoxyphenyl)-6-butylimidazo[2,1-b][1,3]benzothiazole |
| SMILES | CCCCOc1ccc(-c2cn3c(n2)sc2cc(CCCC)ccc23)cc1 |
| InChI | InChI=1S/C23H26N2OS/c1-3-5-7-17-8-13-21-22(15-17)27-23-24-20(16-25(21)23)18-9-11-19(12-10-18)26-14-6-4-2/h8-13,15-16H,3-7,14H2,1-2H3 |
| InChIKey | WTZPXRDXHLZBKS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|