C15H17N3S — CID 96668145
6-(4-butylphenyl)imidazo[2,1-b][1,3]thiazol-3-amine (PubChem CID 96668145) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 6-(4-butylphenyl)imidazo[2,1-b][1,3]thiazol-3-amine.
| Compound Name | 6-(4-butylphenyl)imidazo[2,1-b][1,3]thiazol-3-amine |
|---|---|
| PubChem CID | 96668145 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 6-(4-butylphenyl)imidazo[2,1-b][1,3]thiazol-3-amine |
| SMILES | CCCCc1ccc(-c2cn3c(N)csc3n2)cc1 |
| InChI | InChI=1S/C15H17N3S/c1-2-3-4-11-5-7-12(8-6-11)13-9-18-14(16)10-19-15(18)17-13/h5-10H,2-4,16H2,1H3 |
| InChIKey | HCJUMSPYEAUHDZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |