C20H20N2OS — CID 3968689
6-butyl-2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 3968689) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 6-butyl-2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 6-butyl-2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 3968689 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6-butyl-2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | CCCCc1ccc2c(c1)sc1nc(-c3ccc(OC)cc3)cn12 |
| InChI | InChI=1S/C20H20N2OS/c1-3-4-5-14-6-11-18-19(12-14)24-20-21-17(13-22(18)20)15-7-9-16(23-2)10-8-15/h6-13H,3-5H2,1-2H3 |
| InChIKey | XEKYWPTXQGRTIM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |