C25H35N3O2 — CID 70417422
2-[[4-[3-(dibutylamino)propoxy]phenyl]methyl]imidazo[1,2-a]pyridin-8-ol (PubChem CID 70417422) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-[[4-[3-(dibutylamino)propoxy]phenyl]methyl]imidazo[1,2-a]pyridin-8-ol.
| Compound Name | 2-[[4-[3-(dibutylamino)propoxy]phenyl]methyl]imidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 70417422 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 2-[[4-[3-(dibutylamino)propoxy]phenyl]methyl]imidazo[1,2-a]pyridin-8-ol |
| SMILES | CCCCN(CCCC)CCCOc1ccc(Cc2cn3cccc(O)c3n2)cc1 |
| InChI | InChI=1S/C25H35N3O2/c1-3-5-14-27(15-6-4-2)16-8-18-30-23-12-10-21(11-13-23)19-22-20-28-17-7-9-24(29)25(28)26-22/h7,9-13,17,20,29H,3-6,8,14-16,18-19H2,1-2H3 |
| InChIKey | NVRYBVJVOOSDFS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|