C26H37N3O — CID 14773969
N-butyl-N-[3-[4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)phenoxy]propyl]butan-1-amine (PubChem CID 14773969) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is N-butyl-N-[3-[4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)phenoxy]propyl]butan-1-amine.
| Compound Name | N-butyl-N-[3-[4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)phenoxy]propyl]butan-1-amine |
|---|---|
| PubChem CID | 14773969 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-butyl-N-[3-[4-(3,7-dimethylimidazo[1,2-a]pyridin-2-yl)phenoxy]propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCOc1ccc(-c2nc3cc(C)ccn3c2C)cc1 |
| InChI | InChI=1S/C26H37N3O/c1-5-7-15-28(16-8-6-2)17-9-19-30-24-12-10-23(11-13-24)26-22(4)29-18-14-21(3)20-25(29)27-26/h10-14,18,20H,5-9,15-17,19H2,1-4H3 |
| InChIKey | SAWJLAQEWTXPJS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|