About [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate
[4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate (PubChem CID 3381982) has the molecular formula C28H37N3O2
and a molecular weight of 447.62 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate.
Molecular Properties
| Compound Name | [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate |
| PubChem CID | 3381982 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(-c2nc3cc(C)ccn3c2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C28H37N3O2/c1-3-4-5-6-10-13-26(32)33-24-16-14-22(15-17-24)27-28(29-23-11-8-7-9-12-23)31-19-18-21(2)20-25(31)30-27/h14-20,23,29H,3-13H2,1-2H3 |
| InChIKey | BOFOXEKBELFZBA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate?
The IUPAC name of [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate (CID 3381982) is [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate.
What is the SMILES notation for [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate?
The canonical SMILES for [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate is CCCCCCCC(=O)Oc1ccc(-c2nc3cc(C)ccn3c2NC2CCCCC2)cc1.
What is the InChIKey of [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate?
The InChIKey is BOFOXEKBELFZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37N3O2/c1-3-4-5-6-10-13-26(32)33-24-16-14-22(15-17-24)27-28(29-23-11-8-7-9-12-23)31-19-18-21(2)20-25(31)30-27/h14-20,23,29H,3-13H2,1-2H3.
What are the key properties of [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate?
[4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate has a molecular weight of 447.62 g/mol, XLogP of 7.32, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate is sourced from PubChem (CID 3381982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).