C28H37N3O2 — CID 3381982
[4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate (PubChem CID 3381982) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate.
| Compound Name | [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate |
|---|---|
| PubChem CID | 3381982 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(-c2nc3cc(C)ccn3c2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C28H37N3O2/c1-3-4-5-6-10-13-26(32)33-24-16-14-22(15-17-24)27-28(29-23-11-8-7-9-12-23)31-19-18-21(2)20-25(31)30-27/h14-20,23,29H,3-13H2,1-2H3 |
| InChIKey | BOFOXEKBELFZBA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|