C28H39N3O3S — CID 42743329
[3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octane-1-sulfonate (PubChem CID 42743329) has the molecular formula C28H39N3O3S and a molecular weight of 497.71 g/mol. Its IUPAC name is [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octane-1-sulfonate.
| Compound Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octane-1-sulfonate |
|---|---|
| PubChem CID | 42743329 |
| Molecular Formula | C28H39N3O3S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)Oc1cccc(-c2nc3cc(C)ccn3c2NC2CCCCC2)c1 |
| InChI | InChI=1S/C28H39N3O3S/c1-3-4-5-6-7-11-19-35(32,33)34-25-16-12-13-23(21-25)27-28(29-24-14-9-8-10-15-24)31-18-17-22(2)20-26(31)30-27/h12-13,16-18,20-21,24,29H,3-11,14-15,19H2,1-2H3 |
| InChIKey | IROAOZFXIYXESB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|