C27H29N3O3S — CID 3557743
[2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] phenylmethanesulfonate (PubChem CID 3557743) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is [2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] phenylmethanesulfonate.
| Compound Name | [2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 3557743 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] phenylmethanesulfonate |
| SMILES | Cc1ccn2c(NC3CCCCC3)c(-c3ccccc3OS(=O)(=O)Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C27H29N3O3S/c1-20-16-17-30-25(18-20)29-26(27(30)28-22-12-6-3-7-13-22)23-14-8-9-15-24(23)33-34(31,32)19-21-10-4-2-5-11-21/h2,4-5,8-11,14-18,22,28H,3,6-7,12-13,19H2,1H3 |
| InChIKey | MYKRXQDSXKIZCY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|