C27H22N4O5S — CID 4000156
[2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 4000156) has the molecular formula C27H22N4O5S and a molecular weight of 514.56 g/mol. Its IUPAC name is [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 4000156 |
| Molecular Formula | C27H22N4O5S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3ccccc3OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)nc2c1 |
| InChI | InChI=1S/C27H22N4O5S/c1-19-15-16-30-25(17-19)29-26(27(30)28-18-20-7-3-2-4-8-20)23-9-5-6-10-24(23)36-37(34,35)22-13-11-21(12-14-22)31(32)33/h2-17,28H,18H2,1H3 |
| InChIKey | GNYJICDNEBRVAM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|