C27H21ClN4O5S — CID 3976896
[3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate (PubChem CID 3976896) has the molecular formula C27H21ClN4O5S and a molecular weight of 549.01 g/mol. Its IUPAC name is [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate.
| Compound Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3976896 |
| Molecular Formula | C27H21ClN4O5S |
| Molecular Weight | 549.01 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3cccc(OS(=O)(=O)c4ccc(Cl)c([N+](=O)[O-])c4)c3)nc2c1 |
| InChI | InChI=1S/C27H21ClN4O5S/c1-18-12-13-31-25(14-18)30-26(27(31)29-17-19-6-3-2-4-7-19)20-8-5-9-21(15-20)37-38(35,36)22-10-11-23(28)24(16-22)32(33)34/h2-16,29H,17H2,1H3 |
| InChIKey | FQOPTYFVAOCTKT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.01 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|