C28H21ClN4O4 — CID 42743446
[2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloro-4-nitrobenzoate (PubChem CID 42743446) has the molecular formula C28H21ClN4O4 and a molecular weight of 512.95 g/mol. Its IUPAC name is [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 42743446 |
| Molecular Formula | C28H21ClN4O4 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-chloro-4-nitrobenzoate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3ccccc3OC(=O)c3ccc([N+](=O)[O-])cc3Cl)nc2c1 |
| InChI | InChI=1S/C28H21ClN4O4/c1-18-13-14-32-25(15-18)31-26(27(32)30-17-19-7-3-2-4-8-19)22-9-5-6-10-24(22)37-28(34)21-12-11-20(33(35)36)16-23(21)29/h2-16,30H,17H2,1H3 |
| InChIKey | RISJGYZTBWUTKE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|