C28H22BrN3O2 — CID 42743451
[2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-bromobenzoate (PubChem CID 42743451) has the molecular formula C28H22BrN3O2 and a molecular weight of 512.41 g/mol. Its IUPAC name is [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-bromobenzoate.
| Compound Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 42743451 |
| Molecular Formula | C28H22BrN3O2 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-bromobenzoate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3ccccc3OC(=O)c3ccccc3Br)nc2c1 |
| InChI | InChI=1S/C28H22BrN3O2/c1-19-15-16-32-25(17-19)31-26(27(32)30-18-20-9-3-2-4-10-20)22-12-6-8-14-24(22)34-28(33)21-11-5-7-13-23(21)29/h2-17,30H,18H2,1H3 |
| InChIKey | ARNSHINWMLBDPH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|