C28H23N3O2 — CID 3593940
[2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] benzoate (PubChem CID 3593940) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] benzoate.
| Compound Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 3593940 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] benzoate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3ccccc3OC(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C28H23N3O2/c1-20-16-17-31-25(18-20)30-26(27(31)29-19-21-10-4-2-5-11-21)23-14-8-9-15-24(23)33-28(32)22-12-6-3-7-13-22/h2-18,29H,19H2,1H3 |
| InChIKey | YVOUPABVHAFPCB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|